aboutsummaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rwxr-xr-xassets/.keep0
-rwxr-xr-xassets/favicon/android-chrome-192x192.pngbin0 -> 4251 bytes
-rwxr-xr-xassets/favicon/android-chrome-512x512.pngbin0 -> 13109 bytes
-rwxr-xr-xassets/favicon/apple-touch-icon.pngbin0 -> 3638 bytes
-rwxr-xr-xassets/favicon/favicon-16x16.pngbin0 -> 599 bytes
-rwxr-xr-xassets/favicon/favicon-32x32.pngbin0 -> 1027 bytes
-rwxr-xr-xassets/favicon/favicon.icobin0 -> 15406 bytes
-rwxr-xr-xassets/favicon/site.webmanifest1
-rwxr-xr-xassets/me.webpbin0 -> 453454 bytes
-rwxr-xr-xassets/stylesheet.css2
-rw-r--r--index.html80
-rw-r--r--projects/autograd.html104
-rw-r--r--projects/bubbl.html94
-rw-r--r--projects/chip8emu.html94
-rw-r--r--projects/index.html117
-rw-r--r--projects/msg.html173
16 files changed, 665 insertions, 0 deletions
diff --git a/assets/.keep b/assets/.keep
new file mode 100755
index 0000000..e69de29
--- /dev/null
+++ b/assets/.keep
diff --git a/assets/favicon/android-chrome-192x192.png b/assets/favicon/android-chrome-192x192.png
new file mode 100755
index 0000000..118637d
--- /dev/null
+++ b/assets/favicon/android-chrome-192x192.png
Binary files differ
diff --git a/assets/favicon/android-chrome-512x512.png b/assets/favicon/android-chrome-512x512.png
new file mode 100755
index 0000000..e8e3904
--- /dev/null
+++ b/assets/favicon/android-chrome-512x512.png
Binary files differ
diff --git a/assets/favicon/apple-touch-icon.png b/assets/favicon/apple-touch-icon.png
new file mode 100755
index 0000000..4b9562b
--- /dev/null
+++ b/assets/favicon/apple-touch-icon.png
Binary files differ
diff --git a/assets/favicon/favicon-16x16.png b/assets/favicon/favicon-16x16.png
new file mode 100755
index 0000000..16058a8
--- /dev/null
+++ b/assets/favicon/favicon-16x16.png
Binary files differ
diff --git a/assets/favicon/favicon-32x32.png b/assets/favicon/favicon-32x32.png
new file mode 100755
index 0000000..fb50453
--- /dev/null
+++ b/assets/favicon/favicon-32x32.png
Binary files differ
diff --git a/assets/favicon/favicon.ico b/assets/favicon/favicon.ico
new file mode 100755
index 0000000..5095587
--- /dev/null
+++ b/assets/favicon/favicon.ico
Binary files differ
diff --git a/assets/favicon/site.webmanifest b/assets/favicon/site.webmanifest
new file mode 100755
index 0000000..45dc8a2
--- /dev/null
+++ b/assets/favicon/site.webmanifest
@@ -0,0 +1 @@
+{"name":"","short_name":"","icons":[{"src":"/android-chrome-192x192.png","sizes":"192x192","type":"image/png"},{"src":"/android-chrome-512x512.png","sizes":"512x512","type":"image/png"}],"theme_color":"#ffffff","background_color":"#ffffff","display":"standalone"} \ No newline at end of file
diff --git a/assets/me.webp b/assets/me.webp
new file mode 100755
index 0000000..ba74a5b
--- /dev/null
+++ b/assets/me.webp
Binary files differ
diff --git a/assets/stylesheet.css b/assets/stylesheet.css
new file mode 100755
index 0000000..6b0cd7a
--- /dev/null
+++ b/assets/stylesheet.css
@@ -0,0 +1,2 @@
+/*! tailwindcss v4.1.11 | MIT License | https://tailwindcss.com */
+@layer properties{@supports (((-webkit-hyphens:none)) and (not (margin-trim:inline))) or ((-moz-orient:inline) and (not (color:rgb(from red r g b)))){*,:before,:after,::backdrop{--tw-border-style:solid;--tw-font-weight:initial}}}@layer theme{:root,:host{--font-sans:ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--font-mono:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--color-pink-100:oklch(94.8% .028 342.258);--color-pink-300:oklch(82.3% .12 346.018);--color-pink-800:oklch(45.9% .187 3.815);--color-pink-900:oklch(40.8% .153 2.432);--color-zinc-400:oklch(70.5% .015 286.067);--color-zinc-900:oklch(21% .006 285.885);--spacing:.25rem;--text-sm:.875rem;--text-sm--line-height:calc(1.25/.875);--text-lg:1.125rem;--text-lg--line-height:calc(1.75/1.125);--text-xl:1.25rem;--text-xl--line-height:calc(1.75/1.25);--text-2xl:1.5rem;--text-2xl--line-height:calc(2/1.5);--text-3xl:1.875rem;--text-3xl--line-height:calc(2.25/1.875);--text-5xl:3rem;--text-5xl--line-height:1;--text-7xl:4.5rem;--text-7xl--line-height:1;--font-weight-semibold:600;--font-weight-bold:700;--default-font-family:var(--font-sans);--default-mono-font-family:var(--font-mono)}}@layer base{*,:after,:before,::backdrop{box-sizing:border-box;border:0 solid;margin:0;padding:0}::file-selector-button{box-sizing:border-box;border:0 solid;margin:0;padding:0}html,:host{-webkit-text-size-adjust:100%;tab-size:4;line-height:1.5;font-family:var(--default-font-family,ui-sans-serif,system-ui,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji");font-feature-settings:var(--default-font-feature-settings,normal);font-variation-settings:var(--default-font-variation-settings,normal);-webkit-tap-highlight-color:transparent}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;-webkit-text-decoration:inherit;-webkit-text-decoration:inherit;-webkit-text-decoration:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:var(--default-mono-font-family,ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace);font-feature-settings:var(--default-mono-font-feature-settings,normal);font-variation-settings:var(--default-mono-font-variation-settings,normal);font-size:1em}small{font-size:80%}sub,sup{vertical-align:baseline;font-size:75%;line-height:0;position:relative}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}:-moz-focusring{outline:auto}progress{vertical-align:baseline}summary{display:list-item}ol,ul,menu{list-style:none}img,svg,video,canvas,audio,iframe,embed,object{vertical-align:middle;display:block}img,video{max-width:100%;height:auto}button,input,select,optgroup,textarea{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}::file-selector-button{font:inherit;font-feature-settings:inherit;font-variation-settings:inherit;letter-spacing:inherit;color:inherit;opacity:1;background-color:#0000;border-radius:0}:where(select:is([multiple],[size])) optgroup{font-weight:bolder}:where(select:is([multiple],[size])) optgroup option{padding-inline-start:20px}::file-selector-button{margin-inline-end:4px}::placeholder{opacity:1}@supports (not ((-webkit-appearance:-apple-pay-button))) or (contain-intrinsic-size:1px){::placeholder{color:currentColor}@supports (color:color-mix(in lab, red, red)){::placeholder{color:color-mix(in oklab,currentcolor 50%,transparent)}}}textarea{resize:vertical}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-date-and-time-value{min-height:1lh;text-align:inherit}::-webkit-datetime-edit{display:inline-flex}::-webkit-datetime-edit-fields-wrapper{padding:0}::-webkit-datetime-edit{padding-block:0}::-webkit-datetime-edit-year-field{padding-block:0}::-webkit-datetime-edit-month-field{padding-block:0}::-webkit-datetime-edit-day-field{padding-block:0}::-webkit-datetime-edit-hour-field{padding-block:0}::-webkit-datetime-edit-minute-field{padding-block:0}::-webkit-datetime-edit-second-field{padding-block:0}::-webkit-datetime-edit-millisecond-field{padding-block:0}::-webkit-datetime-edit-meridiem-field{padding-block:0}:-moz-ui-invalid{box-shadow:none}button,input:where([type=button],[type=reset],[type=submit]){appearance:button}::file-selector-button{appearance:button}::-webkit-inner-spin-button{height:auto}::-webkit-outer-spin-button{height:auto}[hidden]:where(:not([hidden=until-found])){display:none!important}code,kbd,samp,pre{font-family:"Jersey 15";font-size:40px}}@layer components{.project-list-heading{padding:calc(var(--spacing)*1);font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}@media (hover:hover){.project-list-heading:is(:where(.group):hover *){background-color:var(--color-pink-100);color:var(--color-pink-900);text-decoration-line:underline}}.project-list-description{border-left-style:var(--tw-border-style);--tw-border-style:dashed;border-style:dashed;border-left-width:3px;border-color:var(--color-pink-300);padding-left:calc(var(--spacing)*3);align-items:center;display:flex}@media (hover:hover){.project-list-description:is(:where(.group):hover *){background-color:var(--color-pink-100);color:var(--color-pink-900);text-decoration-line:underline}}.button{border-style:var(--tw-border-style);padding:calc(var(--spacing)*1);padding-inline:calc(var(--spacing)*4);border-width:2px}@media (hover:hover){.button:hover{background-color:var(--color-pink-100);color:var(--color-pink-900);text-decoration-line:underline}}.button-inverted{border-style:var(--tw-border-style);background-color:var(--color-pink-100);height:100%;color:var(--color-pink-900);border-width:2px;border-color:#0000}.button-inverted ::selection{background-color:var(--color-zinc-400)}.button-inverted::selection{background-color:var(--color-zinc-400)}@media (hover:hover){.button-inverted:hover{border-color:var(--color-pink-300);background-color:var(--color-zinc-900);color:var(--color-pink-300);text-decoration-line:underline}}.card-container{justify-content:center;gap:calc(var(--spacing)*8);padding-inline:calc(var(--spacing)*16);grid-template-columns:repeat(3,minmax(0,1fr));grid-auto-rows:1fr;display:grid}.card-anchor{max-width:calc(var(--spacing)*128);padding-inline:calc(var(--spacing)*4);padding-block:calc(var(--spacing)*2);flex-direction:column;justify-content:center;display:flex}}@layer utilities{.visible{visibility:visible}.absolute{position:absolute}.fixed{position:fixed}.static{position:static}.mx-auto{margin-inline:auto}.prose{color:var(--tw-prose-body);max-width:65ch}.prose :where(p):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.25em;margin-bottom:1.25em}.prose :where([class~=lead]):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-lead);margin-top:1.2em;margin-bottom:1.2em;font-size:1.25em;line-height:1.6}.prose :where(a):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-links);font-weight:500;text-decoration:underline}.prose :where(strong):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-bold);font-weight:600}.prose :where(a strong):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(blockquote strong):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(thead th strong):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit}.prose :where(ol):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.25em;margin-bottom:1.25em;padding-inline-start:1.625em;list-style-type:decimal}.prose :where(ol[type=A]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:upper-alpha}.prose :where(ol[type=a]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:lower-alpha}.prose :where(ol[type=A s]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:upper-alpha}.prose :where(ol[type=a s]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:lower-alpha}.prose :where(ol[type=I]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:upper-roman}.prose :where(ol[type=i]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:lower-roman}.prose :where(ol[type=I s]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:upper-roman}.prose :where(ol[type=i s]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:lower-roman}.prose :where(ol[type="1"]):not(:where([class~=not-prose],[class~=not-prose] *)){list-style-type:decimal}.prose :where(ul):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.25em;margin-bottom:1.25em;padding-inline-start:1.625em;list-style-type:disc}.prose :where(ol>li):not(:where([class~=not-prose],[class~=not-prose] *))::marker{color:var(--tw-prose-counters);font-weight:400}.prose :where(ul>li):not(:where([class~=not-prose],[class~=not-prose] *))::marker{color:var(--tw-prose-bullets)}.prose :where(dt):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-headings);margin-top:1.25em;font-weight:600}.prose :where(hr):not(:where([class~=not-prose],[class~=not-prose] *)){border-color:var(--tw-prose-hr);border-top-width:1px;margin-top:3em;margin-bottom:3em}.prose :where(blockquote):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-quotes);border-inline-start-width:.25rem;border-inline-start-color:var(--tw-prose-quote-borders);quotes:"“""”""‘""’";margin-top:1.6em;margin-bottom:1.6em;padding-inline-start:1em;font-style:italic;font-weight:500}.prose :where(blockquote p:first-of-type):not(:where([class~=not-prose],[class~=not-prose] *)):before{content:open-quote}.prose :where(blockquote p:last-of-type):not(:where([class~=not-prose],[class~=not-prose] *)):after{content:close-quote}.prose :where(h1):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-headings);margin-top:0;margin-bottom:.888889em;font-size:2.25em;font-weight:800;line-height:1.11111}.prose :where(h1 strong):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit;font-weight:900}.prose :where(h2):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-headings);margin-top:2em;margin-bottom:1em;font-size:1.5em;font-weight:700;line-height:1.33333}.prose :where(h2 strong):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit;font-weight:800}.prose :where(h3):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-headings);margin-top:1.6em;margin-bottom:.6em;font-size:1.25em;font-weight:600;line-height:1.6}.prose :where(h3 strong):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit;font-weight:700}.prose :where(h4):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-headings);margin-top:1.5em;margin-bottom:.5em;font-weight:600;line-height:1.5}.prose :where(h4 strong):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit;font-weight:700}.prose :where(img):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:2em;margin-bottom:2em}.prose :where(picture):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:2em;margin-bottom:2em;display:block}.prose :where(video):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:2em;margin-bottom:2em}.prose :where(kbd):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-kbd);box-shadow:0 0 0 1px rgb(var(--tw-prose-kbd-shadows)/10%),0 3px 0 rgb(var(--tw-prose-kbd-shadows)/10%);padding-top:.1875em;padding-inline-end:.375em;padding-bottom:.1875em;border-radius:.3125rem;padding-inline-start:.375em;font-family:inherit;font-size:.875em;font-weight:500}.prose :where(code):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-code);font-size:.875em;font-weight:600}.prose :where(code):not(:where([class~=not-prose],[class~=not-prose] *)):before,.prose :where(code):not(:where([class~=not-prose],[class~=not-prose] *)):after{content:"`"}.prose :where(a code):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(h1 code):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit}.prose :where(h2 code):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit;font-size:.875em}.prose :where(h3 code):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit;font-size:.9em}.prose :where(h4 code):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(blockquote code):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(thead th code):not(:where([class~=not-prose],[class~=not-prose] *)){color:inherit}.prose :where(pre):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-pre-code);background-color:var(--tw-prose-pre-bg);padding-top:.857143em;padding-inline-end:1.14286em;padding-bottom:.857143em;border-radius:.375rem;margin-top:1.71429em;margin-bottom:1.71429em;padding-inline-start:1.14286em;font-size:.875em;font-weight:400;line-height:1.71429;overflow-x:auto}.prose :where(pre code):not(:where([class~=not-prose],[class~=not-prose] *)){font-weight:inherit;color:inherit;font-size:inherit;font-family:inherit;line-height:inherit;background-color:#0000;border-width:0;border-radius:0;padding:0}.prose :where(pre code):not(:where([class~=not-prose],[class~=not-prose] *)):before,.prose :where(pre code):not(:where([class~=not-prose],[class~=not-prose] *)):after{content:none}.prose :where(table):not(:where([class~=not-prose],[class~=not-prose] *)){table-layout:auto;width:100%;margin-top:2em;margin-bottom:2em;font-size:.875em;line-height:1.71429}.prose :where(thead):not(:where([class~=not-prose],[class~=not-prose] *)){border-bottom-width:1px;border-bottom-color:var(--tw-prose-th-borders)}.prose :where(thead th):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-headings);vertical-align:bottom;padding-inline-end:.571429em;padding-bottom:.571429em;padding-inline-start:.571429em;font-weight:600}.prose :where(tbody tr):not(:where([class~=not-prose],[class~=not-prose] *)){border-bottom-width:1px;border-bottom-color:var(--tw-prose-td-borders)}.prose :where(tbody tr:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){border-bottom-width:0}.prose :where(tbody td):not(:where([class~=not-prose],[class~=not-prose] *)){vertical-align:baseline}.prose :where(tfoot):not(:where([class~=not-prose],[class~=not-prose] *)){border-top-width:1px;border-top-color:var(--tw-prose-th-borders)}.prose :where(tfoot td):not(:where([class~=not-prose],[class~=not-prose] *)){vertical-align:top}.prose :where(th,td):not(:where([class~=not-prose],[class~=not-prose] *)){text-align:start}.prose :where(figure>*):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:0}.prose :where(figcaption):not(:where([class~=not-prose],[class~=not-prose] *)){color:var(--tw-prose-captions);margin-top:.857143em;font-size:.875em;line-height:1.42857}.prose{--tw-prose-body:oklch(37.3% .034 259.733);--tw-prose-headings:oklch(21% .034 264.665);--tw-prose-lead:oklch(44.6% .03 256.802);--tw-prose-links:oklch(21% .034 264.665);--tw-prose-bold:oklch(21% .034 264.665);--tw-prose-counters:oklch(55.1% .027 264.364);--tw-prose-bullets:oklch(87.2% .01 258.338);--tw-prose-hr:oklch(92.8% .006 264.531);--tw-prose-quotes:oklch(21% .034 264.665);--tw-prose-quote-borders:oklch(92.8% .006 264.531);--tw-prose-captions:oklch(55.1% .027 264.364);--tw-prose-kbd:oklch(21% .034 264.665);--tw-prose-kbd-shadows:NaN NaN NaN;--tw-prose-code:oklch(21% .034 264.665);--tw-prose-pre-code:oklch(92.8% .006 264.531);--tw-prose-pre-bg:oklch(27.8% .033 256.848);--tw-prose-th-borders:oklch(87.2% .01 258.338);--tw-prose-td-borders:oklch(92.8% .006 264.531);--tw-prose-invert-body:oklch(87.2% .01 258.338);--tw-prose-invert-headings:#fff;--tw-prose-invert-lead:oklch(70.7% .022 261.325);--tw-prose-invert-links:#fff;--tw-prose-invert-bold:#fff;--tw-prose-invert-counters:oklch(70.7% .022 261.325);--tw-prose-invert-bullets:oklch(44.6% .03 256.802);--tw-prose-invert-hr:oklch(37.3% .034 259.733);--tw-prose-invert-quotes:oklch(96.7% .003 264.542);--tw-prose-invert-quote-borders:oklch(37.3% .034 259.733);--tw-prose-invert-captions:oklch(70.7% .022 261.325);--tw-prose-invert-kbd:#fff;--tw-prose-invert-kbd-shadows:255 255 255;--tw-prose-invert-code:#fff;--tw-prose-invert-pre-code:oklch(87.2% .01 258.338);--tw-prose-invert-pre-bg:#00000080;--tw-prose-invert-th-borders:oklch(44.6% .03 256.802);--tw-prose-invert-td-borders:oklch(37.3% .034 259.733);font-size:1rem;line-height:1.75}.prose :where(picture>img):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:0}.prose :where(li):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.5em;margin-bottom:.5em}.prose :where(ol>li):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(ul>li):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:.375em}.prose :where(.prose>ul>li p):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.75em;margin-bottom:.75em}.prose :where(.prose>ul>li>p:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.25em}.prose :where(.prose>ul>li>p:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:1.25em}.prose :where(.prose>ol>li>p:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.25em}.prose :where(.prose>ol>li>p:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:1.25em}.prose :where(ul ul,ul ol,ol ul,ol ol):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.75em;margin-bottom:.75em}.prose :where(dl):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.25em;margin-bottom:1.25em}.prose :where(dd):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.5em;padding-inline-start:1.625em}.prose :where(hr+*):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(h2+*):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(h3+*):not(:where([class~=not-prose],[class~=not-prose] *)),.prose :where(h4+*):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0}.prose :where(thead th:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:0}.prose :where(thead th:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:0}.prose :where(tbody td,tfoot td):not(:where([class~=not-prose],[class~=not-prose] *)){padding-top:.571429em;padding-inline-end:.571429em;padding-bottom:.571429em;padding-inline-start:.571429em}.prose :where(tbody td:first-child,tfoot td:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:0}.prose :where(tbody td:last-child,tfoot td:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:0}.prose :where(figure):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:2em;margin-bottom:2em}.prose :where(.prose>:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0}.prose :where(.prose>:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:0}.mt-2{margin-top:calc(var(--spacing)*2)}.mt-3{margin-top:calc(var(--spacing)*3)}.mt-10{margin-top:calc(var(--spacing)*10)}.contents{display:contents}.flex{display:flex}.inline-grid{display:inline-grid}.max-h-56{max-height:calc(var(--spacing)*56)}.min-h-screen{min-height:100vh}.w-full{width:100%}.max-w-100{max-width:calc(var(--spacing)*100)}.max-w-120{max-width:calc(var(--spacing)*120)}.max-w-256{max-width:calc(var(--spacing)*256)}.flex-grow{flex-grow:1}.cursor-pointer{cursor:pointer}.grid-cols-\[max-content_1fr\]{grid-template-columns:max-content 1fr}.flex-col{flex-direction:column}.flex-wrap{flex-wrap:wrap}.items-center{align-items:center}.justify-center{justify-content:center}.gap-1{gap:calc(var(--spacing)*1)}.gap-2{gap:calc(var(--spacing)*2)}.gap-4{gap:calc(var(--spacing)*4)}.gap-8{gap:calc(var(--spacing)*8)}.gap-y-5{row-gap:calc(var(--spacing)*5)}.border-t-2{border-top-style:var(--tw-border-style);border-top-width:2px}.border-t-4{border-top-style:var(--tw-border-style);border-top-width:4px}.bg-pink-100{background-color:var(--color-pink-100)}.bg-zinc-900{background-color:var(--color-zinc-900)}.p-2{padding:calc(var(--spacing)*2)}.p-16{padding:calc(var(--spacing)*16)}.px-8{padding-inline:calc(var(--spacing)*8)}.px-10{padding-inline:calc(var(--spacing)*10)}.px-14{padding-inline:calc(var(--spacing)*14)}.py-1{padding-block:calc(var(--spacing)*1)}.py-8{padding-block:calc(var(--spacing)*8)}.pt-2{padding-top:calc(var(--spacing)*2)}.pt-4{padding-top:calc(var(--spacing)*4)}.pt-12{padding-top:calc(var(--spacing)*12)}.pb-4{padding-bottom:calc(var(--spacing)*4)}.text-center{text-align:center}.font-\[\'Jersey_15\'\]{font-family:"Jersey 15"}.text-2xl{font-size:var(--text-2xl);line-height:var(--tw-leading,var(--text-2xl--line-height))}.text-5xl{font-size:var(--text-5xl);line-height:var(--tw-leading,var(--text-5xl--line-height))}.text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}.text-sm{font-size:var(--text-sm);line-height:var(--tw-leading,var(--text-sm--line-height))}.text-xl{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}.font-bold{--tw-font-weight:var(--font-weight-bold);font-weight:var(--font-weight-bold)}.font-semibold{--tw-font-weight:var(--font-weight-semibold);font-weight:var(--font-weight-semibold)}.text-wrap{text-wrap:wrap}.text-pink-300{color:var(--color-pink-300)}.text-pink-900{color:var(--color-pink-900)}.prose-invert{--tw-prose-body:var(--tw-prose-invert-body);--tw-prose-headings:var(--tw-prose-invert-headings);--tw-prose-lead:var(--tw-prose-invert-lead);--tw-prose-links:var(--tw-prose-invert-links);--tw-prose-bold:var(--tw-prose-invert-bold);--tw-prose-counters:var(--tw-prose-invert-counters);--tw-prose-bullets:var(--tw-prose-invert-bullets);--tw-prose-hr:var(--tw-prose-invert-hr);--tw-prose-quotes:var(--tw-prose-invert-quotes);--tw-prose-quote-borders:var(--tw-prose-invert-quote-borders);--tw-prose-captions:var(--tw-prose-invert-captions);--tw-prose-kbd:var(--tw-prose-invert-kbd);--tw-prose-kbd-shadows:var(--tw-prose-invert-kbd-shadows);--tw-prose-code:var(--tw-prose-invert-code);--tw-prose-pre-code:var(--tw-prose-invert-pre-code);--tw-prose-pre-bg:var(--tw-prose-invert-pre-bg);--tw-prose-th-borders:var(--tw-prose-invert-th-borders);--tw-prose-td-borders:var(--tw-prose-invert-td-borders)}.prose-pink{--tw-prose-links:oklch(59.2% .249 .584);--tw-prose-invert-links:oklch(65.6% .241 354.308)}.selection\:bg-pink-100 ::selection{background-color:var(--color-pink-100)}.selection\:bg-pink-100::selection{background-color:var(--color-pink-100)}.selection\:bg-zinc-400 ::selection{background-color:var(--color-zinc-400)}.selection\:bg-zinc-400::selection{background-color:var(--color-zinc-400)}.selection\:text-pink-800 ::selection{color:var(--color-pink-800)}.selection\:text-pink-800::selection{color:var(--color-pink-800)}.selection\:text-pink-900 ::selection{color:var(--color-pink-900)}.selection\:text-pink-900::selection{color:var(--color-pink-900)}@media (hover:hover){.hover\:underline:hover{text-decoration-line:underline}}@media (min-width:48rem){.md\:prose-lg{font-size:1.125rem;line-height:1.77778}.md\:prose-lg :where(p):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em;margin-bottom:1.33333em}.md\:prose-lg :where([class~=lead]):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.09091em;margin-bottom:1.09091em;font-size:1.22222em;line-height:1.45455}.md\:prose-lg :where(blockquote):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.66667em;margin-bottom:1.66667em;padding-inline-start:1em}.md\:prose-lg :where(h1):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:.833333em;font-size:2.66667em;line-height:1}.md\:prose-lg :where(h2):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.86667em;margin-bottom:1.06667em;font-size:1.66667em;line-height:1.33333}.md\:prose-lg :where(h3):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.66667em;margin-bottom:.666667em;font-size:1.33333em;line-height:1.5}.md\:prose-lg :where(h4):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.77778em;margin-bottom:.444444em;line-height:1.55556}.md\:prose-lg :where(img):not(:where([class~=not-prose],[class~=not-prose] *)),.md\:prose-lg :where(picture):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.77778em;margin-bottom:1.77778em}.md\:prose-lg :where(picture>img):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:0}.md\:prose-lg :where(video):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.77778em;margin-bottom:1.77778em}.md\:prose-lg :where(kbd):not(:where([class~=not-prose],[class~=not-prose] *)){padding-top:.222222em;padding-inline-end:.444444em;padding-bottom:.222222em;border-radius:.3125rem;padding-inline-start:.444444em;font-size:.888889em}.md\:prose-lg :where(code):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.888889em}.md\:prose-lg :where(h2 code):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.866667em}.md\:prose-lg :where(h3 code):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.875em}.md\:prose-lg :where(pre):not(:where([class~=not-prose],[class~=not-prose] *)){padding-top:1em;padding-inline-end:1.5em;padding-bottom:1em;border-radius:.375rem;margin-top:2em;margin-bottom:2em;padding-inline-start:1.5em;font-size:.888889em;line-height:1.75}.md\:prose-lg :where(ol):not(:where([class~=not-prose],[class~=not-prose] *)),.md\:prose-lg :where(ul):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em;margin-bottom:1.33333em;padding-inline-start:1.55556em}.md\:prose-lg :where(li):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.666667em;margin-bottom:.666667em}.md\:prose-lg :where(ol>li):not(:where([class~=not-prose],[class~=not-prose] *)),.md\:prose-lg :where(ul>li):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:.444444em}.md\:prose-lg :where(.md\:prose-lg>ul>li p):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.888889em;margin-bottom:.888889em}.md\:prose-lg :where(.md\:prose-lg>ul>li>p:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em}.md\:prose-lg :where(.md\:prose-lg>ul>li>p:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:1.33333em}.md\:prose-lg :where(.md\:prose-lg>ol>li>p:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em}.md\:prose-lg :where(.md\:prose-lg>ol>li>p:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:1.33333em}.md\:prose-lg :where(ul ul,ul ol,ol ul,ol ol):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.888889em;margin-bottom:.888889em}.md\:prose-lg :where(dl):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em;margin-bottom:1.33333em}.md\:prose-lg :where(dt):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em}.md\:prose-lg :where(dd):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.666667em;padding-inline-start:1.55556em}.md\:prose-lg :where(hr):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:3.11111em;margin-bottom:3.11111em}.md\:prose-lg :where(hr+*):not(:where([class~=not-prose],[class~=not-prose] *)),.md\:prose-lg :where(h2+*):not(:where([class~=not-prose],[class~=not-prose] *)),.md\:prose-lg :where(h3+*):not(:where([class~=not-prose],[class~=not-prose] *)),.md\:prose-lg :where(h4+*):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0}.md\:prose-lg :where(table):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.888889em;line-height:1.5}.md\:prose-lg :where(thead th):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:.75em;padding-bottom:.75em;padding-inline-start:.75em}.md\:prose-lg :where(thead th:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:0}.md\:prose-lg :where(thead th:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:0}.md\:prose-lg :where(tbody td,tfoot td):not(:where([class~=not-prose],[class~=not-prose] *)){padding-top:.75em;padding-inline-end:.75em;padding-bottom:.75em;padding-inline-start:.75em}.md\:prose-lg :where(tbody td:first-child,tfoot td:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:0}.md\:prose-lg :where(tbody td:last-child,tfoot td:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:0}.md\:prose-lg :where(figure):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.77778em;margin-bottom:1.77778em}.md\:prose-lg :where(figure>*):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:0}.md\:prose-lg :where(figcaption):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1em;font-size:.888889em;line-height:1.5}.md\:prose-lg :where(.md\:prose-lg>:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0}.md\:prose-lg :where(.md\:prose-lg>:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:0}.md\:text-lg{font-size:var(--text-lg);line-height:var(--tw-leading,var(--text-lg--line-height))}}@media (min-width:64rem){.lg\:prose-2xl{font-size:1.5rem;line-height:1.66667}.lg\:prose-2xl :where(p):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em;margin-bottom:1.33333em}.lg\:prose-2xl :where([class~=lead]):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.06667em;margin-bottom:1.06667em;font-size:1.25em;line-height:1.46667}.lg\:prose-2xl :where(blockquote):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.77778em;margin-bottom:1.77778em;padding-inline-start:1.11111em}.lg\:prose-2xl :where(h1):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:.875em;font-size:2.66667em;line-height:1}.lg\:prose-2xl :where(h2):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.5em;margin-bottom:.833333em;font-size:2em;line-height:1.08333}.lg\:prose-2xl :where(h3):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.55556em;margin-bottom:.666667em;font-size:1.5em;line-height:1.22222}.lg\:prose-2xl :where(h4):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.66667em;margin-bottom:.666667em;line-height:1.5}.lg\:prose-2xl :where(img):not(:where([class~=not-prose],[class~=not-prose] *)),.lg\:prose-2xl :where(picture):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:2em;margin-bottom:2em}.lg\:prose-2xl :where(picture>img):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:0}.lg\:prose-2xl :where(video):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:2em;margin-bottom:2em}.lg\:prose-2xl :where(kbd):not(:where([class~=not-prose],[class~=not-prose] *)){padding-top:.25em;padding-inline-end:.333333em;padding-bottom:.25em;border-radius:.375rem;padding-inline-start:.333333em;font-size:.833333em}.lg\:prose-2xl :where(code):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.833333em}.lg\:prose-2xl :where(h2 code):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.875em}.lg\:prose-2xl :where(h3 code):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.888889em}.lg\:prose-2xl :where(pre):not(:where([class~=not-prose],[class~=not-prose] *)){padding-top:1.2em;padding-inline-end:1.6em;padding-bottom:1.2em;border-radius:.5rem;margin-top:2em;margin-bottom:2em;padding-inline-start:1.6em;font-size:.833333em;line-height:1.8}.lg\:prose-2xl :where(ol):not(:where([class~=not-prose],[class~=not-prose] *)),.lg\:prose-2xl :where(ul):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em;margin-bottom:1.33333em;padding-inline-start:1.58333em}.lg\:prose-2xl :where(li):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.5em;margin-bottom:.5em}.lg\:prose-2xl :where(ol>li):not(:where([class~=not-prose],[class~=not-prose] *)),.lg\:prose-2xl :where(ul>li):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:.416667em}.lg\:prose-2xl :where(.lg\:prose-2xl>ul>li p):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.833333em;margin-bottom:.833333em}.lg\:prose-2xl :where(.lg\:prose-2xl>ul>li>p:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em}.lg\:prose-2xl :where(.lg\:prose-2xl>ul>li>p:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:1.33333em}.lg\:prose-2xl :where(.lg\:prose-2xl>ol>li>p:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em}.lg\:prose-2xl :where(.lg\:prose-2xl>ol>li>p:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:1.33333em}.lg\:prose-2xl :where(ul ul,ul ol,ol ul,ol ol):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.666667em;margin-bottom:.666667em}.lg\:prose-2xl :where(dl):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em;margin-bottom:1.33333em}.lg\:prose-2xl :where(dt):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1.33333em}.lg\:prose-2xl :where(dd):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:.5em;padding-inline-start:1.58333em}.lg\:prose-2xl :where(hr):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:3em;margin-bottom:3em}.lg\:prose-2xl :where(hr+*):not(:where([class~=not-prose],[class~=not-prose] *)),.lg\:prose-2xl :where(h2+*):not(:where([class~=not-prose],[class~=not-prose] *)),.lg\:prose-2xl :where(h3+*):not(:where([class~=not-prose],[class~=not-prose] *)),.lg\:prose-2xl :where(h4+*):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0}.lg\:prose-2xl :where(table):not(:where([class~=not-prose],[class~=not-prose] *)){font-size:.833333em;line-height:1.4}.lg\:prose-2xl :where(thead th):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:.6em;padding-bottom:.8em;padding-inline-start:.6em}.lg\:prose-2xl :where(thead th:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:0}.lg\:prose-2xl :where(thead th:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:0}.lg\:prose-2xl :where(tbody td,tfoot td):not(:where([class~=not-prose],[class~=not-prose] *)){padding-top:.8em;padding-inline-end:.6em;padding-bottom:.8em;padding-inline-start:.6em}.lg\:prose-2xl :where(tbody td:first-child,tfoot td:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-start:0}.lg\:prose-2xl :where(tbody td:last-child,tfoot td:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){padding-inline-end:0}.lg\:prose-2xl :where(figure):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:2em;margin-bottom:2em}.lg\:prose-2xl :where(figure>*):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0;margin-bottom:0}.lg\:prose-2xl :where(figcaption):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:1em;font-size:.833333em;line-height:1.6}.lg\:prose-2xl :where(.lg\:prose-2xl>:first-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-top:0}.lg\:prose-2xl :where(.lg\:prose-2xl>:last-child):not(:where([class~=not-prose],[class~=not-prose] *)){margin-bottom:0}.lg\:text-2xl{font-size:var(--text-2xl);line-height:var(--tw-leading,var(--text-2xl--line-height))}.lg\:text-3xl{font-size:var(--text-3xl);line-height:var(--tw-leading,var(--text-3xl--line-height))}.lg\:text-7xl{font-size:var(--text-7xl);line-height:var(--tw-leading,var(--text-7xl--line-height))}.lg\:text-xl{font-size:var(--text-xl);line-height:var(--tw-leading,var(--text-xl--line-height))}}.prose{--tw-prose-body:var(--color-text);--tw-prose-headings:var(--color-primary);--tw-prose-links:var(--color-primary);--tw-prose-bold:var(--color-primary-light);--tw-prose-hr:var(--color-border);--tw-prose-code:var(--color-primary);--tw-prose-quotes:var(--color-primary)}.prose a:hover{color:var(--color-primary-light)}}@property --tw-border-style{syntax:"*";inherits:false;initial-value:solid}@property --tw-font-weight{syntax:"*";inherits:false} \ No newline at end of file
diff --git a/index.html b/index.html
new file mode 100644
index 0000000..4d4facd
--- /dev/null
+++ b/index.html
@@ -0,0 +1,80 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+
+ <meta charset="UTF-8">
+ <meta name="viewport" content="width=device-width, initial-scale=1.0">
+ <meta http-equiv="X-UA-Compatible" content="ie=edge">
+ <meta name="description" content="RAGHURAM SUBRAMANI ~ COMPROMYSE | Hacker & Programmer">
+
+ <title>HOME | COMPROMYSE</title>
+
+ <link rel="apple-touch-icon" sizes="180x180" href="/assets/favicon/apple-touch-icon.png">
+ <link rel="icon" type="image/png" sizes="32x32" href="/assets/favicon/favicon-32x32.png">
+ <link rel="icon" type="image/png" sizes="16x16" href="/assets/favicon/favicon-16x16.png">
+ <link rel="manifest" href="/assets/favicon/site.webmanifest">
+
+ <link href="/assets/stylesheet.css" rel="stylesheet" />
+
+ <link rel="preconnect" href="https://fonts.googleapis.com">
+ <link rel="preconnect" href="https://fonts.gstatic.com" crossorigin>
+ <link href="https://fonts.googleapis.com/css2?family=Jersey+15&display=swap" rel="stylesheet">
+
+ </head>
+ <body class="bg-zinc-900 text-pink-300 font-['Jersey_15'] selection:text-pink-900 selection:bg-pink-100 lg:text-xl">
+ <div class="min-h-screen flex flex-col">
+
+ <nav class="w-full mx-auto mt-10">
+ <div class="flex flex-wrap items-center px-10 gap-4 text-center text-lg lg:text-2xl">
+
+ <a href="/" class="cursor-pointer font-bold hover:underline justify-center button">
+ COMPROMYSE
+ </a>
+
+ <div class="flex items-center gap-4 flex-wrap justify-center md:justify-left">
+ <a href="/projects" class="hover:underline">
+ [ PROJECTS ]
+ </a>
+
+ </div>
+
+ </div>
+</nav>
+
+
+ <div class="flex flex-grow flex-col">
+
+
+<div class="p-16 flex-grow flex items-center justify-center">
+
+ <div class="flex flex-wrap gap-8">
+ <img src="/assets/me.webp" class="max-h-56" />
+ <div class="flex flex-col justify-center gap-1">
+ <h1 class="text-5xl lg:text-7xl">
+ Hi there! I'm RAGHU.
+ </h1>
+ <p class="text-xl lg:text-3xl"><span class="text-pink-900 bg-pink-100 selection:bg-zinc-400 selection:text-pink-800 p-2">Programmer and Hacker.</span></p>
+
+ <div class="flex gap-2 lg:text-xl pt-4">
+ <a href="https://github.com/compromyse" class="button" target="_blank">GITHUB</a>
+ <a href="https://www.linkedin.com/in/compromyse" class="button" target="_blank">LINKEDIN</a>
+ </div>
+ </div>
+ </div>
+
+</div>
+
+ </div>
+
+ <footer class="w-full pb-4 pt-12 px-8 text-sm md:text-lg">
+ <div class="text-center">
+ <p>The Quieter You Become, The More You Are Able To Hear.</p>
+ </div>
+</footer>
+
+
+ </div>
+ </body>
+</html>
+
+
diff --git a/projects/autograd.html b/projects/autograd.html
new file mode 100644
index 0000000..4fe4ae0
--- /dev/null
+++ b/projects/autograd.html
@@ -0,0 +1,104 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+
+ <meta charset="UTF-8">
+ <meta name="viewport" content="width=device-width, initial-scale=1.0">
+ <meta http-equiv="X-UA-Compatible" content="ie=edge">
+ <meta name="description" content="RAGHURAM SUBRAMANI ~ COMPROMYSE | Hacker & Programmer">
+
+ <title>Autograd | COMPROMYSE</title>
+
+ <link rel="apple-touch-icon" sizes="180x180" href="/assets/favicon/apple-touch-icon.png">
+ <link rel="icon" type="image/png" sizes="32x32" href="/assets/favicon/favicon-32x32.png">
+ <link rel="icon" type="image/png" sizes="16x16" href="/assets/favicon/favicon-16x16.png">
+ <link rel="manifest" href="/assets/favicon/site.webmanifest">
+
+ <link href="/assets/stylesheet.css" rel="stylesheet" />
+
+ <link rel="preconnect" href="https://fonts.googleapis.com">
+ <link rel="preconnect" href="https://fonts.gstatic.com" crossorigin>
+ <link href="https://fonts.googleapis.com/css2?family=Jersey+15&display=swap" rel="stylesheet">
+
+ <link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/styles/base16/ashes.min.css" defer>
+ <script src="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/highlight.min.js"></script>
+ <script defer>hljs.highlightAll();</script>
+
+ </head>
+ <body class="bg-zinc-900 text-pink-300 font-['Jersey_15'] selection:text-pink-900 selection:bg-pink-100 lg:text-xl">
+ <div class="min-h-screen flex flex-col">
+
+ <nav class="w-full mx-auto mt-10">
+ <div class="flex flex-wrap items-center px-10 gap-4 text-center text-lg lg:text-2xl">
+
+ <a href="/" class="cursor-pointer font-bold hover:underline justify-center button">
+ COMPROMYSE
+ </a>
+
+ <div class="flex items-center gap-4 flex-wrap justify-center md:justify-left">
+ <a href="/projects" class="hover:underline">
+ [ PROJECTS ]
+ </a>
+
+ </div>
+
+ </div>
+</nav>
+
+
+ <div class="flex flex-grow flex-col py-8 px-14 items-center">
+
+ <div class="text-center flex flex-col gap-4 w-full max-w-100">
+ <h1 class="text-5xl font-semibold">Autograd</h1>
+ <div>
+ <h4 class="text-xl">An implementation of autograd / backpropagation.</h4>
+ <h6 class="text-center text-sm border-t-4 mt-2 py-1">Python</h6>
+ </div>
+
+ <a href="https://github.com/compromyse/autograd" target="_blank" class="button">SOURCE</a>
+ </div>
+
+ <div class="prose md:prose-lg lg:prose-2xl prose-pink prose-invert w-full max-w-256 pt-12">
+ <p>All you need to run a simple neural network using autograd is the following code:</p>
+
+<p>The code defines a data set <code>X</code>, expected output (or ground truth) <code>y</code>. It then trains the neural network by performing backward propagation (<code>.backward()</code>), then applies the calculated gradients through <code>.optimise()</code> along with a learning rate of <code>0.01</code>.</p>
+
+<p><pre><code class="py">from src.nn import MLP
+from src.loss import mse
+
+X = [
+ [ 0.0, 1.0, 2.0 ],
+ [ 2.0, 1.0, 0.0 ],
+ [ 2.0, 2.0, 2.0 ],
+ [ 3.0, 3.0, 3.0 ]
+]
+
+y = [ 1.0, -1.0, 1.0, -1.0 ]
+n = MLP(3, [ 4, 4, 1 ])
+
+for i in range(400):
+ pred = [ n(x) for x in X ]
+ loss = mse(y, pred)
+ loss.zero_grad()
+ loss.backward()
+ n.optimise(0.01)
+
+print(pred)
+</code></pre>
+</p>
+
+ </div>
+
+ </div>
+ <footer class="w-full pb-4 pt-12 px-8 text-sm md:text-lg">
+ <div class="text-center">
+ <p>The Quieter You Become, The More You Are Able To Hear.</p>
+ </div>
+</footer>
+
+
+ </div>
+ </body>
+</html>
+
+
diff --git a/projects/bubbl.html b/projects/bubbl.html
new file mode 100644
index 0000000..0ead19a
--- /dev/null
+++ b/projects/bubbl.html
@@ -0,0 +1,94 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+
+ <meta charset="UTF-8">
+ <meta name="viewport" content="width=device-width, initial-scale=1.0">
+ <meta http-equiv="X-UA-Compatible" content="ie=edge">
+ <meta name="description" content="RAGHURAM SUBRAMANI ~ COMPROMYSE | Hacker & Programmer">
+
+ <title>BUBBL | COMPROMYSE</title>
+
+ <link rel="apple-touch-icon" sizes="180x180" href="/assets/favicon/apple-touch-icon.png">
+ <link rel="icon" type="image/png" sizes="32x32" href="/assets/favicon/favicon-32x32.png">
+ <link rel="icon" type="image/png" sizes="16x16" href="/assets/favicon/favicon-16x16.png">
+ <link rel="manifest" href="/assets/favicon/site.webmanifest">
+
+ <link href="/assets/stylesheet.css" rel="stylesheet" />
+
+ <link rel="preconnect" href="https://fonts.googleapis.com">
+ <link rel="preconnect" href="https://fonts.gstatic.com" crossorigin>
+ <link href="https://fonts.googleapis.com/css2?family=Jersey+15&display=swap" rel="stylesheet">
+
+ <link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/styles/base16/ashes.min.css" defer>
+ <script src="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/highlight.min.js"></script>
+ <script defer>hljs.highlightAll();</script>
+
+ </head>
+ <body class="bg-zinc-900 text-pink-300 font-['Jersey_15'] selection:text-pink-900 selection:bg-pink-100 lg:text-xl">
+ <div class="min-h-screen flex flex-col">
+
+ <nav class="w-full mx-auto mt-10">
+ <div class="flex flex-wrap items-center px-10 gap-4 text-center text-lg lg:text-2xl">
+
+ <a href="/" class="cursor-pointer font-bold hover:underline justify-center button">
+ COMPROMYSE
+ </a>
+
+ <div class="flex items-center gap-4 flex-wrap justify-center md:justify-left">
+ <a href="/projects" class="hover:underline">
+ [ PROJECTS ]
+ </a>
+
+ </div>
+
+ </div>
+</nav>
+
+
+ <div class="flex flex-grow flex-col py-8 px-14 items-center">
+
+ <div class="text-center flex flex-col gap-4 w-full max-w-100">
+ <h1 class="text-5xl font-semibold">BUBBL</h1>
+ <div>
+ <h4 class="text-xl">An Operating System for The x86 Architecture.</h4>
+ <h6 class="text-center text-sm border-t-4 mt-2 py-1">C / C++ / ASM</h6>
+ </div>
+
+ <a href="https://github.com/compromyse/bubbl" target="_blank" class="button">SOURCE</a>
+ </div>
+
+ <div class="prose md:prose-lg lg:prose-2xl prose-pink prose-invert w-full max-w-256 pt-12">
+ <h2>Building</h2>
+
+<h4>Dependencies: Nix with flakes enabled and (optionally) direnv</h4>
+
+<p>After entering the devshell (with direnv or <code>nix develop</code>),</p>
+
+<p><pre><code class="sh">mkdir build &amp;&amp; cd build
+cmake -G Ninja ..
+ninja
+</code></pre>
+</p>
+
+<h2>Running</h2>
+
+<p><pre><code class="sh">ninja run # or run-headless or run-gdb
+</code></pre>
+</p>
+
+ </div>
+
+ </div>
+ <footer class="w-full pb-4 pt-12 px-8 text-sm md:text-lg">
+ <div class="text-center">
+ <p>The Quieter You Become, The More You Are Able To Hear.</p>
+ </div>
+</footer>
+
+
+ </div>
+ </body>
+</html>
+
+
diff --git a/projects/chip8emu.html b/projects/chip8emu.html
new file mode 100644
index 0000000..7e0aab0
--- /dev/null
+++ b/projects/chip8emu.html
@@ -0,0 +1,94 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+
+ <meta charset="UTF-8">
+ <meta name="viewport" content="width=device-width, initial-scale=1.0">
+ <meta http-equiv="X-UA-Compatible" content="ie=edge">
+ <meta name="description" content="RAGHURAM SUBRAMANI ~ COMPROMYSE | Hacker & Programmer">
+
+ <title>CHIP8Emu | COMPROMYSE</title>
+
+ <link rel="apple-touch-icon" sizes="180x180" href="/assets/favicon/apple-touch-icon.png">
+ <link rel="icon" type="image/png" sizes="32x32" href="/assets/favicon/favicon-32x32.png">
+ <link rel="icon" type="image/png" sizes="16x16" href="/assets/favicon/favicon-16x16.png">
+ <link rel="manifest" href="/assets/favicon/site.webmanifest">
+
+ <link href="/assets/stylesheet.css" rel="stylesheet" />
+
+ <link rel="preconnect" href="https://fonts.googleapis.com">
+ <link rel="preconnect" href="https://fonts.gstatic.com" crossorigin>
+ <link href="https://fonts.googleapis.com/css2?family=Jersey+15&display=swap" rel="stylesheet">
+
+ <link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/styles/base16/ashes.min.css" defer>
+ <script src="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/highlight.min.js"></script>
+ <script defer>hljs.highlightAll();</script>
+
+ </head>
+ <body class="bg-zinc-900 text-pink-300 font-['Jersey_15'] selection:text-pink-900 selection:bg-pink-100 lg:text-xl">
+ <div class="min-h-screen flex flex-col">
+
+ <nav class="w-full mx-auto mt-10">
+ <div class="flex flex-wrap items-center px-10 gap-4 text-center text-lg lg:text-2xl">
+
+ <a href="/" class="cursor-pointer font-bold hover:underline justify-center button">
+ COMPROMYSE
+ </a>
+
+ <div class="flex items-center gap-4 flex-wrap justify-center md:justify-left">
+ <a href="/projects" class="hover:underline">
+ [ PROJECTS ]
+ </a>
+
+ </div>
+
+ </div>
+</nav>
+
+
+ <div class="flex flex-grow flex-col py-8 px-14 items-center">
+
+ <div class="text-center flex flex-col gap-4 w-full max-w-100">
+ <h1 class="text-5xl font-semibold">CHIP8Emu</h1>
+ <div>
+ <h4 class="text-xl">An Emulator/Interpreter for CHIP-8.</h4>
+ <h6 class="text-center text-sm border-t-4 mt-2 py-1">C++</h6>
+ </div>
+
+ <a href="https://github.com/compromyse/autograd" target="_blank" class="button">SOURCE</a>
+ </div>
+
+ <div class="prose md:prose-lg lg:prose-2xl prose-pink prose-invert w-full max-w-256 pt-12">
+ <p><img src="https://github.com/compromyse/CHIP8Emu/assets/71056504/f87e9e73-f880-4d60-a61b-cdb40791211b" class="mx-auto" /></p>
+
+<h2>About The Project</h2>
+
+<p>CHIP8Emu is an emulator for the 1977 interpreter CHIP-8 written in C++. It aims to make games designed for the same playable on modern hardware.</p>
+
+<h2>Compilation &amp; Usage</h2>
+
+<p>For compilation, you need Clang, CMake, GNUMake, and SDL2. With them installed, run the following.
+<pre><code class="sh">mkdir build; cd build
+cmake ..
+make
+</code></pre>
+Replace <code>[scale]</code> with your preferred display scaling, <code>[delay]</code> with the your preferred delay, and <code>[ROM]</code> with the path to the game you intend to play.
+<pre><code class="sh">./chip8emu [scale] [delay] [ROM]
+</code></pre>
+</p>
+
+ </div>
+
+ </div>
+ <footer class="w-full pb-4 pt-12 px-8 text-sm md:text-lg">
+ <div class="text-center">
+ <p>The Quieter You Become, The More You Are Able To Hear.</p>
+ </div>
+</footer>
+
+
+ </div>
+ </body>
+</html>
+
+
diff --git a/projects/index.html b/projects/index.html
new file mode 100644
index 0000000..4696f4b
--- /dev/null
+++ b/projects/index.html
@@ -0,0 +1,117 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+
+ <meta charset="UTF-8">
+ <meta name="viewport" content="width=device-width, initial-scale=1.0">
+ <meta http-equiv="X-UA-Compatible" content="ie=edge">
+ <meta name="description" content="RAGHURAM SUBRAMANI ~ COMPROMYSE | Hacker & Programmer">
+
+ <title>PROJECTS | COMPROMYSE</title>
+
+ <link rel="apple-touch-icon" sizes="180x180" href="/assets/favicon/apple-touch-icon.png">
+ <link rel="icon" type="image/png" sizes="32x32" href="/assets/favicon/favicon-32x32.png">
+ <link rel="icon" type="image/png" sizes="16x16" href="/assets/favicon/favicon-16x16.png">
+ <link rel="manifest" href="/assets/favicon/site.webmanifest">
+
+ <link href="/assets/stylesheet.css" rel="stylesheet" />
+
+ <link rel="preconnect" href="https://fonts.googleapis.com">
+ <link rel="preconnect" href="https://fonts.gstatic.com" crossorigin>
+ <link href="https://fonts.googleapis.com/css2?family=Jersey+15&display=swap" rel="stylesheet">
+
+ </head>
+ <body class="bg-zinc-900 text-pink-300 font-['Jersey_15'] selection:text-pink-900 selection:bg-pink-100 lg:text-xl">
+ <div class="min-h-screen flex flex-col">
+
+ <nav class="w-full mx-auto mt-10">
+ <div class="flex flex-wrap items-center px-10 gap-4 text-center text-lg lg:text-2xl">
+
+ <a href="/" class="cursor-pointer font-bold hover:underline justify-center button">
+ COMPROMYSE
+ </a>
+
+ <div class="flex items-center gap-4 flex-wrap justify-center md:justify-left">
+ <a href="/projects" class="hover:underline">
+ [ PROJECTS ]
+ </a>
+
+ </div>
+
+ </div>
+</nav>
+
+
+ <div class="flex flex-grow flex-col">
+
+
+<div class="p-16">
+ <h1 class="text-5xl">PROJECTS</h1>
+ <p class="text-xl">Here's a bunch of things I've done.</p>
+</div>
+
+<div class="card-container">
+
+
+
+ <a href="/projects/msg" class="card-anchor button-inverted">
+ <div class="flex flex-col gap-2 pt-2 items-center items-center">
+ <p class="text-2xl font-semibold text-center">MSG</p>
+ <p class="text-xl text-center text-wrap">An incredibly opinionated, hackable, minimal Static Site Generator.</p>
+ </div>
+
+ <div class="text-center text-sm border-t-2 mt-3 py-1">C</div>
+ </a>
+
+
+
+ <a href="/projects/bubbl" class="card-anchor button-inverted">
+ <div class="flex flex-col gap-2 pt-2 items-center items-center">
+ <p class="text-2xl font-semibold text-center">BUBBL</p>
+ <p class="text-xl text-center text-wrap">An Operating System for The x86 Architecture.</p>
+ </div>
+
+ <div class="text-center text-sm border-t-2 mt-3 py-1">C / C++ / ASM</div>
+ </a>
+
+
+
+ <a href="/projects/chip8emu" class="card-anchor button-inverted">
+ <div class="flex flex-col gap-2 pt-2 items-center items-center">
+ <p class="text-2xl font-semibold text-center">CHIP8Emu</p>
+ <p class="text-xl text-center text-wrap">An Emulator/Interpreter for CHIP-8.</p>
+ </div>
+
+ <div class="text-center text-sm border-t-2 mt-3 py-1">C++</div>
+ </a>
+
+
+
+ <a href="/projects/autograd" class="card-anchor button-inverted">
+ <div class="flex flex-col gap-2 pt-2 items-center items-center">
+ <p class="text-2xl font-semibold text-center">Autograd</p>
+ <p class="text-xl text-center text-wrap">An implementation of autograd / backpropagation.</p>
+ </div>
+
+ <div class="text-center text-sm border-t-2 mt-3 py-1">Python</div>
+ </a>
+
+
+
+</div>
+
+
+ </div>
+
+ <footer class="w-full pb-4 pt-12 px-8 text-sm md:text-lg">
+ <div class="text-center">
+ <p>The Quieter You Become, The More You Are Able To Hear.</p>
+ </div>
+</footer>
+
+
+ </div>
+ </body>
+</html>
+
+
diff --git a/projects/msg.html b/projects/msg.html
new file mode 100644
index 0000000..3b30c62
--- /dev/null
+++ b/projects/msg.html
@@ -0,0 +1,173 @@
+<!DOCTYPE html>
+<html lang="en">
+ <head>
+
+ <meta charset="UTF-8">
+ <meta name="viewport" content="width=device-width, initial-scale=1.0">
+ <meta http-equiv="X-UA-Compatible" content="ie=edge">
+ <meta name="description" content="RAGHURAM SUBRAMANI ~ COMPROMYSE | Hacker & Programmer">
+
+ <title>MSG | COMPROMYSE</title>
+
+ <link rel="apple-touch-icon" sizes="180x180" href="/assets/favicon/apple-touch-icon.png">
+ <link rel="icon" type="image/png" sizes="32x32" href="/assets/favicon/favicon-32x32.png">
+ <link rel="icon" type="image/png" sizes="16x16" href="/assets/favicon/favicon-16x16.png">
+ <link rel="manifest" href="/assets/favicon/site.webmanifest">
+
+ <link href="/assets/stylesheet.css" rel="stylesheet" />
+
+ <link rel="preconnect" href="https://fonts.googleapis.com">
+ <link rel="preconnect" href="https://fonts.gstatic.com" crossorigin>
+ <link href="https://fonts.googleapis.com/css2?family=Jersey+15&display=swap" rel="stylesheet">
+
+ <link rel="stylesheet" href="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/styles/base16/ashes.min.css" defer>
+ <script src="https://cdnjs.cloudflare.com/ajax/libs/highlight.js/11.11.1/highlight.min.js"></script>
+ <script defer>hljs.highlightAll();</script>
+
+ </head>
+ <body class="bg-zinc-900 text-pink-300 font-['Jersey_15'] selection:text-pink-900 selection:bg-pink-100 lg:text-xl">
+ <div class="min-h-screen flex flex-col">
+
+ <nav class="w-full mx-auto mt-10">
+ <div class="flex flex-wrap items-center px-10 gap-4 text-center text-lg lg:text-2xl">
+
+ <a href="/" class="cursor-pointer font-bold hover:underline justify-center button">
+ COMPROMYSE
+ </a>
+
+ <div class="flex items-center gap-4 flex-wrap justify-center md:justify-left">
+ <a href="/projects" class="hover:underline">
+ [ PROJECTS ]
+ </a>
+
+ </div>
+
+ </div>
+</nav>
+
+
+ <div class="flex flex-grow flex-col py-8 px-14 items-center">
+
+ <div class="text-center flex flex-col gap-4 w-full max-w-100">
+ <h1 class="text-5xl font-semibold">MSG</h1>
+ <div>
+ <h4 class="text-xl">An incredibly opinionated, hackable, minimal Static Site Generator.</h4>
+ <h6 class="text-center text-sm border-t-4 mt-2 py-1">C</h6>
+ </div>
+
+ <a href="https://github.com/compromyse/msg" target="_blank" class="button">SOURCE</a>
+ </div>
+
+ <div class="prose md:prose-lg lg:prose-2xl prose-pink prose-invert w-full max-w-256 pt-12">
+ <p>See <a href="https://github.com/compromyse/compromyse.xyz">github.com/compromyse/compromyse.xyz</a> for an example site.</p>
+
+<h3>Compilation &amp; Usage</h3>
+
+<p><pre><code class="sh"># REQUIREMENTS: CMake, Git, GCC/Clang, GNUMake/Ninja
+$ git clone https://github.com/compromyse/msg
+$ mkdir build &amp;&amp; cd build
+$ cmake ..
+$ make # or ninja
+$ ./msg -h
+msg: The Minimal Static Site Generator
+
+Usage: ./msg [-h] [-w] [-v] [-o &lt;output&gt;] &lt;directory&gt;
+ -h : Help
+ -w : Watch working directory for changes
+ -v : Verbose
+ -o &lt;output&gt;: Output directory
+ &lt;directory&gt;: Working directory
+</code></pre>
+</p>
+
+<h3>Site Structure</h3>
+
+<p><pre><code class="sh">.
+├── assets
+│   └── me.webp
+├── config.cfg
+├── index.html
+├── partials
+│   ├── footer.html
+│   ├── navbar.html
+├── projects.html
+└── templates
+ └── base.html
+</code></pre>
+</p>
+
+<h3>Features</h3>
+
+<h4>Includes - include files from <code>/partials</code></h4>
+
+<p><pre><code class="html">&lt;!-- index.html --&gt;
+&lt;html&gt;
+ &lt;body&gt;
+ {{ include "navbar.html" }}
+ ...
+ &lt;/body&gt;
+&lt;/html&gt;
+</code></pre>
+</p>
+
+<h4>Contentfor - define content for templates</h4>
+
+<p><pre><code class="html">&lt;!-- templates/base.html --&gt;
+&lt;html&gt;
+ &lt;head&gt;
+ {{ content "head" }}
+ &lt;/head&gt;
+ &lt;body&gt;
+ {{ body }}
+ &lt;/body&gt;
+&lt;/html&gt;
+
+&lt;!-- index.html --&gt;
+{{ contentfor "head" }}
+&lt;title&gt;HOME&lt;/title&gt;
+{{ endcontent }}
+
+&lt;p&gt;...&lt;/p&gt;
+</code></pre>
+</p>
+
+<h4>Eachdo - iterate over resources</h4>
+
+<p><pre><code class="html">&lt;!-- projects/xyz.html --&gt;
+title = XYZ
+---
+
+&lt;h1&gt;XYZ!&lt;/h1&gt;
+
+&lt;!-- index.html --&gt;
+{{ eachdo resources.projects }}
+&lt;p&gt;{{ put title }}&lt;/p&gt;
+{{ endeachdo }}
+</code></pre>
+</p>
+
+<h4>Template - specify template for page</h4>
+
+<p><pre><code class="html">&lt;!-- projects/xyz.html --&gt;
+template = base_tailwind.html
+---
+
+&lt;h1 class="p-2"&gt;XYZ!&lt;/h1&gt;
+</code></pre>
+</p>
+
+ </div>
+
+ </div>
+ <footer class="w-full pb-4 pt-12 px-8 text-sm md:text-lg">
+ <div class="text-center">
+ <p>The Quieter You Become, The More You Are Able To Hear.</p>
+ </div>
+</footer>
+
+
+ </div>
+ </body>
+</html>
+
+